CAS 100045-83-8

Tributyl((methoxymethoxy)methyl)stannane

Description:

Tributyl((methoxymethoxy)methyl)stannane, with the CAS number 100045-83-8, is an organotin compound characterized by the presence of a tin atom bonded to three butyl groups and a methoxymethoxy methyl group. This compound typically exhibits properties associated with organotin compounds, such as moderate to high stability and solubility in organic solvents. It is often utilized in various applications, including as a coupling agent, stabilizer, or reagent in organic synthesis. The presence of the methoxymethoxy group enhances its reactivity and potential for functionalization, making it valuable in polymer chemistry and materials science. Additionally, organotin compounds can exhibit toxicity, particularly in aquatic environments, necessitating careful handling and disposal. Overall, tributyl((methoxymethoxy)methyl)stannane is a versatile compound with significant implications in both industrial and research settings, although its environmental impact should be considered in its application.

Formula: C₁₅H₃₄O₂Sn

InChI: InChI=1/3C4H9.C3H7O2.Sn/c3*1-3-4-2;1-4-3-5-2;/h3*1,3-4H2,2H3;1,3H2,2H3;/rC15H34O2Sn/c1-5-8-11-18(12-9-6-2,13-10-7-3)15-17-14-16-4/h5-15H2,1-4H3

InChI key: MHKKJWZUBFCJSI-UHFFFAOYSA-N

SMILES: CCCC[Sn](CCCC)(CCCC)COCOC

[(Methoxymethoxy)methyl]tributylstannane

Controlled Product

CAS: 100045-83-8

Applications Reagent used to conduct (Methoxymethoxy)methyl additions
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₅H₃₄O₂Sn

Color and Shape: Neat

Molecular weight: 365.14

Ref: TR-M263000

Tributyl((methoxymethoxy)methyl)stannane

CAS: 100045-83-8

Formula: C₁₅H₃₄O₂Sn

Purity: 90%

Color and Shape: Liquid

Molecular weight: 365.1303

Ref: IN-DA0000NT