CymitQuimica logo

CAS 1000520-92-2

:

4-Fluoro-3-methylphenylacetic acid

Description:
4-Fluoro-3-methylphenylacetic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methyl group on a phenyl ring, which contributes to its unique chemical properties. The molecular structure consists of a phenyl ring substituted at the para position with a fluorine atom and at the meta position with a methyl group, along with an acetic acid functional group. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic aromatic nature. Its acidity is attributed to the carboxylic acid group, which can donate protons in solution. The presence of the fluorine atom can influence the compound's reactivity, polarity, and biological activity, making it of interest in pharmaceutical and chemical research. Additionally, the compound may exhibit specific interactions with biological targets, potentially leading to applications in drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H9FO2
InChI:InChI=1S/C9H9FO2/c1-6-4-7(5-9(11)12)2-3-8(6)10/h2-4H,5H2,1H3,(H,11,12)
InChI key:VZDGZGNZGMJNPR-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)CC(=O)O)F
Found 5 products.