CymitQuimica logo

CAS 1000565-32-1

:

2-pyridineacetic acid, 6-(trifluoromethyl)-

Description:
2-Pyridineacetic acid, 6-(trifluoromethyl)-, with the CAS number 1000565-32-1, is an organic compound characterized by its pyridine ring structure substituted with both an acetic acid group and a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. This compound typically exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification or amidation. The pyridine moiety contributes to its aromatic character and can engage in hydrogen bonding, which may affect solubility in polar solvents. Additionally, the trifluoromethyl group can impart unique electronic properties, making the compound of interest in medicinal chemistry and material science. Overall, 2-pyridineacetic acid, 6-(trifluoromethyl)- is a versatile compound with potential applications in pharmaceuticals and agrochemicals, owing to its distinctive structural features and functional groups.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c9-8(10,11)6-3-1-2-5(12-6)4-7(13)14/h1-3H,4H2,(H,13,14)
InChI key:WRPOGLABYJEOEX-UHFFFAOYSA-N
SMILES:c1cc(CC(=O)O)nc(c1)C(F)(F)F
Synonyms:
  • [6-(Trifluoromethyl)-2-pyridinyl]acetic acid
  • (6-Trifluoromethyl-pyridin-2-yl)-acetic acid
Found 3 products.