CymitQuimica logo

CAS 1000576-48-6

:

2,6-Dibromo-3-fluoro-4-methylbenzenamine

Description:
2,6-Dibromo-3-fluoro-4-methylbenzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms, one fluorine atom, and one methyl group, along with an amino group. The presence of these substituents influences its chemical properties, such as reactivity and polarity. The bromine atoms, being strong electron-withdrawing groups, can enhance the compound's electrophilic character, while the amino group can participate in hydrogen bonding, affecting solubility in polar solvents. This compound is likely to exhibit moderate to high stability under standard conditions, but may undergo reactions typical of aromatic amines, such as electrophilic substitution. Its fluorine atom can also impart unique properties, such as increased lipophilicity and potential bioactivity. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where halogenated aromatic amines are often explored for their biological activity. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C7H6Br2FN
InChI:InChI=1S/C7H6Br2FN/c1-3-2-4(8)7(11)5(9)6(3)10/h2H,11H2,1H3
InChI key:InChIKey=NCWXWVWAGZEBDB-UHFFFAOYSA-N
SMILES:FC1=C(Br)C(N)=C(Br)C=C1C
Synonyms:
  • 2,6-Dibromo-3-fluoro-4-methylbenzenamine
  • Benzenamine, 2,6-dibromo-3-fluoro-4-methyl-
  • 2,6-Dibromo-3-fluoro-4-methyl-phenylamine
Sort by

Found 0 products.