CymitQuimica logo

CAS 1000576-59-9

:

1H-Indazole,7-bromo-1-methyl-

Description:
1H-Indazole, 7-bromo-1-methyl- is a heterocyclic organic compound characterized by its indazole structure, which consists of a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 7-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other complex molecules. The bromine substituent can participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the indazole framework is known for its involvement in various pharmacological activities, which may include anti-inflammatory and anticancer properties. As with many brominated compounds, caution should be exercised regarding its handling and disposal due to potential environmental and health impacts.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c1-11-8-6(5-10-11)3-2-4-7(8)9/h2-5H,1H3
InChI key:JPFIGGYULRKROG-UHFFFAOYSA-N
SMILES:CN1C2=C(C=CC=C2Br)C=N1
Synonyms:
  • 7-Bromo-1-methyl-1H-indazole
Found 4 products.