CymitQuimica logo

CAS 1000576-60-2

:

Benzene, 1-bromo-5-fluoro-2-iodo-3-methyl-

Description:
Benzene, 1-bromo-5-fluoro-2-iodo-3-methyl- is a halogenated aromatic compound characterized by the presence of multiple substituents on a benzene ring. The structure includes a bromine atom, a fluorine atom, an iodine atom, and a methyl group, which contribute to its unique chemical properties. This compound is likely to exhibit moderate to high reactivity due to the presence of halogens, which can participate in various substitution reactions. The presence of the methyl group can influence the electron density of the aromatic ring, potentially affecting its reactivity and stability. Additionally, the different halogens can impart distinct physical properties, such as solubility and boiling point, compared to non-halogenated benzene derivatives. The compound may also exhibit interesting biological activity, making it of interest in fields such as medicinal chemistry and materials science. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with halogenated compounds.
Formula:C7H5BrFI
InChI:InChI=1S/C7H5BrFI/c1-4-2-5(9)3-6(8)7(4)10/h2-3H,1H3
InChI key:InChIKey=FGWWSTPAPGETQF-UHFFFAOYSA-N
SMILES:IC1=C(Br)C=C(F)C=C1C
Synonyms:
  • Benzene, 1-bromo-5-fluoro-2-iodo-3-methyl-
  • 1-Bromo-5-fluoro-2-iodo-3-methylbenzene
Found 5 products.