CAS 1000577-59-2

1-Methyl-5-(phenylmethyl)-2-piperazinone

Description:

1-Methyl-5-(phenylmethyl)-2-piperazinone is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group at the 1-position and a phenylmethyl group at the 5-position, contributing to its unique properties. It is typically classified as a piperazinone derivative, which may exhibit various biological activities, making it of interest in medicinal chemistry. The presence of the phenylmethyl group can enhance lipophilicity, potentially influencing its pharmacokinetic properties. The compound may also participate in hydrogen bonding due to the carbonyl group in the piperazinone structure, which can affect its solubility and reactivity. Additionally, the molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many piperazine derivatives, it may also exhibit psychoactive properties, warranting further investigation into its effects and mechanisms of action. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₂H₁₆N₂O

InChI: InChI=1S/C12H16N2O/c1-14-9-11(13-8-12(14)15)7-10-5-3-2-4-6-10/h2-6,11,13H,7-9H2,1H3

InChI key: InChIKey=AKDJPULYWQWHOS-UHFFFAOYSA-N

SMILES: C(C1CN(C)C(=O)CN1)C2=CC=CC=C2

Synonyms:

• 2-Piperazinone, 1-methyl-5-(phenylmethyl)-
• 1-Methyl-5-(phenylmethyl)-2-piperazinone

5-Benzyl-1-methylpiperazin-2-one

CAS: 1000577-59-2

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 240.73 g/mol

Ref: 3D-AQB57759