CAS 1000577-85-4: 2-Amino-5-chloro-6-fluoro-3-iodobenzonitrile
Description:2-Amino-5-chloro-6-fluoro-3-iodobenzonitrile is an organic compound characterized by its complex structure, which includes an amino group, halogen substituents (chlorine, fluorine, and iodine), and a nitrile functional group. This compound features a benzene ring with various substituents that influence its chemical reactivity and physical properties. The presence of the amino group suggests potential basicity and the ability to participate in hydrogen bonding, while the halogen atoms can impart unique electronic properties and influence the compound's reactivity in nucleophilic substitution reactions. The nitrile group contributes to the compound's polarity and can also participate in various chemical reactions, such as hydrolysis or reduction. Due to its halogenated nature, this compound may exhibit interesting biological activities, making it of interest in pharmaceutical and agrochemical research. Its specific melting point, boiling point, solubility, and other physical properties would depend on the molecular interactions and the environment in which it is studied.
Formula:C7H3ClFIN2
InChI:InChI=1S/C7H3ClFIN2/c8-4-1-5(10)7(12)3(2-11)6(4)9/h1H,12H2
InChI key:InChIKey=SHKGZYTZNRSZAQ-UHFFFAOYSA-N
SMILES:N#CC=1C(F)=C(Cl)C=C(I)C1N
- Synonyms:
- Benzonitrile, 2-amino-5-chloro-6-fluoro-3-iodo-
- 2-Amino-5-chloro-6-fluoro-3-iodobenzonitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Amino-5-chloro-6-fluoro-3-iodobenzonitrile REF: 10-F035151CAS: 1000577-85-4 | 95.0% | To inquire | Tue 20 May 25 |

2-Amino-5-chloro-6-fluoro-3-iodobenzonitrile
Ref: 10-F035151
1g | To inquire | ||
5g | 1,507.00 € |