CAS 1000577-87-6
:Ethyl 2-[(4-chloro-7-quinazolinyl)oxy]acetate
Description:
Ethyl 2-[(4-chloro-7-quinazolinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes an ethyl ester functional group and a quinazoline moiety. The presence of the 4-chloro substituent on the quinazoline ring contributes to its potential biological activity, as halogenated compounds often exhibit enhanced pharmacological properties. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is soluble in organic solvents, which is common for esters and heterocyclic compounds. Ethyl 2-[(4-chloro-7-quinazolinyl)oxy]acetate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Safety data sheets should be consulted for handling and toxicity information, as compounds with halogenated groups can pose environmental and health risks. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural characteristics in determining chemical behavior and potential applications.
Formula:C12H11ClN2O3
InChI:InChI=1S/C12H11ClN2O3/c1-2-17-11(16)6-18-8-3-4-9-10(5-8)14-7-15-12(9)13/h3-5,7H,2,6H2,1H3
InChI key:InChIKey=UGGIDCDRRBNSNV-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(OCC(OCC)=O)C=C2)N=CN1
Synonyms:- Acetic acid, 2-[(4-chloro-7-quinazolinyl)oxy]-, ethyl ester
- Ethyl 2-[(4-chloro-7-quinazolinyl)oxy]acetate
Sort by
Found 1 products.
