CymitQuimica logo

CAS 1000578-08-4

:

2,4-Dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine

Description:
2,4-Dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features two chlorine atoms at the 2 and 4 positions, contributing to its reactivity and potential biological activity. The tetrahydropyrido moiety indicates that the compound has a saturated nitrogen-containing ring, which may influence its solubility and interaction with biological systems. Typically, compounds of this nature are investigated for their pharmacological properties, including potential use as pharmaceuticals or agrochemicals. The presence of chlorine atoms can enhance lipophilicity, affecting the compound's absorption and distribution in biological systems. Additionally, the structural features may allow for various substitution reactions, making it a versatile intermediate in organic synthesis. As with many heterocycles, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups.
Formula:C7H7Cl2N3
InChI:InChI=1S/C7H7Cl2N3/c8-6-4-1-2-10-3-5(4)11-7(9)12-6/h10H,1-3H2
InChI key:IPSIICUFLIHDCA-UHFFFAOYSA-N
SMILES:C1CNCC2=C1C(=NC(=N2)Cl)Cl
Synonyms:
  • 2,4-dichloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine HCl salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.