
CAS 1000578-23-3
:1,5-Dibromo-2-iodo-3-(trifluoromethoxy)benzene
Description:
1,5-Dibromo-2-iodo-3-(trifluoromethoxy)benzene is an organic compound characterized by its complex halogenated aromatic structure. It features two bromine atoms and one iodine atom attached to a benzene ring, along with a trifluoromethoxy group, which significantly influences its chemical properties. The presence of multiple halogens enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its trifluoromethoxy group contributes to its lipophilicity and can affect its biological activity. Additionally, the compound's physical properties, such as solubility and melting point, are influenced by the halogen substituents, which can also impart unique electronic characteristics. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 1,5-Dibromo-2-iodo-3-(trifluoromethoxy)benzene is a valuable compound in advanced chemical synthesis.
Formula:C7H2Br2F3IO
InChI:InChI=1S/C7H2Br2F3IO/c8-3-1-4(9)6(13)5(2-3)14-7(10,11)12/h1-2H
InChI key:InChIKey=WZGLRXSAYIDYOB-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(I)C(Br)=CC(Br)=C1
Synonyms:- Benzene, 1,5-dibromo-2-iodo-3-(trifluoromethoxy)-
- 1,5-Dibromo-2-iodo-3-(trifluoromethoxy)benzene
Sort by
Found 0 products.