CymitQuimica logo

CAS 10006-74-3

:

2-Amino-3-ethoxypyridine

Description:
2-Amino-3-ethoxypyridine, with the CAS number 10006-74-3, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and an ethoxy group (-OCH2CH3) attached to the pyridine ring, specifically at the 2 and 3 positions, respectively. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The ethoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. 2-Amino-3-ethoxypyridine is of interest in medicinal chemistry and may serve as a building block for the synthesis of pharmaceuticals or agrochemicals. Its properties, including boiling point, melting point, and specific reactivity, can vary based on the conditions and purity of the sample.
Formula:C7H10N2O
InChI:InChI=1/C7H10N2O/c1-2-10-6-4-3-5-9-7(6)8/h3-5H,2H2,1H3,(H2,8,9)
InChI key:ASJVXZBTTFDZDW-UHFFFAOYSA-N
SMILES:CCOc1cccnc1N
Synonyms:
  • 3-Ethoxy-2-pyridinylamine
  • 3-Ethoxypyridin-2-Amine
Found 4 products.