CymitQuimica logo

CAS 10006-81-2

:

1H-Isoindole, 2,3-dihydro-1,3,4,7-tetramethyl-

Description:
1H-Isoindole, 2,3-dihydro-1,3,4,7-tetramethyl- (CAS 10006-81-2) is an organic compound characterized by its bicyclic structure, which includes an isoindole framework. This compound features a dihydro configuration, indicating the presence of two hydrogen atoms that saturate the double bonds in the isoindole ring. The presence of four methyl groups contributes to its overall hydrophobicity and influences its physical properties, such as boiling and melting points. Typically, compounds of this nature exhibit moderate solubility in organic solvents and limited solubility in water due to their hydrophobic character. The compound may also display interesting biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential reactivity in various chemical reactions, including electrophilic substitutions and cycloadditions. However, specific reactivity and stability can vary based on environmental conditions and the presence of other functional groups. Overall, 1H-Isoindole, 2,3-dihydro-1,3,4,7-tetramethyl- is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c1-7-5-6-8(2)12-10(4)13-9(3)11(7)12/h5-6,9-10,13H,1-4H3
InChI key:OZDRQLMBGZGYCT-UHFFFAOYSA-N
SMILES:CC1C2=C(C=CC(=C2C(N1)C)C)C
Found 1 products.