CymitQuimica logo

CAS 100063-22-7

:

Methyl 3-amino-5-phenylthiophene-2-carboxylate

Description:
Methyl 3-amino-5-phenylthiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the thiophene structure, contributing to its reactivity and potential applications in organic synthesis and pharmaceuticals. The presence of the phenyl group enhances its aromatic character and may influence its electronic properties. Methyl 3-amino-5-phenylthiophene-2-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical behavior can be influenced by the functional groups present, allowing for various reactions such as nucleophilic substitutions or coupling reactions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C12H11NO2S
InChI:InChI=1/C12H11NO2S/c1-15-12(14)11-9(13)7-10(16-11)8-5-3-2-4-6-8/h2-7H,13H2,1H3
InChI key:QESSCNMSOLRYBO-UHFFFAOYSA-N
SMILES:COC(=O)c1c(cc(c2ccccc2)s1)N
Synonyms:
  • Methyl 3-Amino-5-Phenyl-2-Thiophenecarboxylate
  • 3-Amino-5-Phenylthiophene-2-Carboxylic Acid
  • methyl-3-amino-5-phenylthiophene-2-carboxylate
Found 4 products.