CymitQuimica logo

CAS 100066-79-3

:

tert-butyl 2-amino-1-benzyl-4,5-dimethyl-1H-pyrrole-3-carboxylate

Description:
Tert-butyl 2-amino-1-benzyl-4,5-dimethyl-1H-pyrrole-3-carboxylate, with the CAS number 100066-79-3, is a chemical compound characterized by its complex structure, which includes a pyrrole ring substituted with various functional groups. This compound features a tert-butyl ester group, which enhances its lipophilicity and stability. The presence of an amino group contributes to its potential as a building block in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The benzyl group attached to the pyrrole ring can influence the compound's reactivity and interaction with biological targets. Additionally, the dimethyl substitutions on the pyrrole ring may affect its electronic properties and steric hindrance, which can be crucial for its biological activity. Overall, this compound's unique structural features make it of interest in various chemical research applications, including drug design and synthesis. Its properties, such as solubility and reactivity, would depend on the specific conditions under which it is used.
Formula:C18H24N2O2
InChI:InChI=1/C18H24N2O2/c1-12-13(2)20(11-14-9-7-6-8-10-14)16(19)15(12)17(21)22-18(3,4)5/h6-10H,11,19H2,1-5H3
SMILES:Cc1c(C)n(Cc2ccccc2)c(c1C(=O)OC(C)(C)C)N
Synonyms:
  • 1H-Pyrrole-3-carboxylic acid, 2-amino-4,5-dimethyl-1-(phenylmethyl)-, 1,1-dimethylethyl ester
  • tert-Butyl 2-amino-1-benzyl-4,5-dimethyl-1H-pyrrole-3-carboxylate
Sort by
Found 1 products.