CAS 1000690-85-6
:4-[(R)-Phenyl[3-(trifluoromethyl)phenyl]methyl]-1-piperazineacetic acid
Description:
4-[(R)-Phenyl[3-(trifluoromethyl)phenyl]methyl]-1-piperazineacetic acid is a chemical compound characterized by its complex structure, which includes a piperazine ring, a phenyl group, and a trifluoromethyl substituent. The presence of the piperazine moiety suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. The trifluoromethyl group enhances lipophilicity and can influence the compound's interaction with biological targets. This compound is typically classified as an amino acid derivative due to the presence of the acetic acid functional group, which contributes to its potential solubility in polar solvents. Its chirality, indicated by the (R) configuration, may affect its biological activity and interactions with receptors or enzymes. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific pharmacological profiles. However, detailed studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C20H21F3N2O2
InChI:InChI=1S/C20H21F3N2O2/c21-20(22,23)17-8-4-7-16(13-17)19(15-5-2-1-3-6-15)25-11-9-24(10-12-25)14-18(26)27/h1-8,13,19H,9-12,14H2,(H,26,27)/t19-/m1/s1
InChI key:InChIKey=MDLQJNCGZVDZFV-LJQANCHMSA-N
SMILES:[C@@H](C1=CC(C(F)(F)F)=CC=C1)(N2CCN(CC(O)=O)CC2)C3=CC=CC=C3
Synonyms:- 1-Piperazineacetic acid, 4-[(R)-phenyl[3-(trifluoromethyl)phenyl]methyl]-
- Tilapertin
- 4-[(R)-Phenyl[3-(trifluoromethyl)phenyl]methyl]-1-piperazineacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tilapertin
CAS:Tilapertin is a drug that has been shown to be effective in reducing inflammation and sensitivity by inhibiting the production of TNF-α. It belongs to a class of drugs called DPP-4 inhibitors, which are used to treat type 2 diabetes. Tilapertin increases insulin sensitivity and may also reduce the risk of developing type 2 diabetes. The drug's anti-inflammatory effects have been demonstrated in vitro and in vivo, with an effect on human erythrocytes. This drug inhibits TNF-α production through its inhibition of the enzyme dipeptidyl peptidase 4 (DPP-4) that is required for the activation of proinflammatory cytokines such as IL-1β and IL-6. It also prevents the binding of proinflammatory cytokines to their receptors, preventing inflammation.Formula:C20H21F3N2O2Purity:Min. 95%Molecular weight:378.4 g/molTilapertin
CAS:Tilapertin is an oral glycine transporter type-1 inhibitor.Formula:C20H21F3N2O2Purity:98%Color and Shape:SolidMolecular weight:378.39

