CymitQuimica logo

CAS 10007-84-8

:

Benzoic acid, 2,6-dichloro-, sodium salt (1:1)

Description:
Benzoic acid, 2,6-dichloro-, sodium salt (1:1), commonly referred to as sodium 2,6-dichlorobenzoate, is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with two chlorine atoms at the 2 and 6 positions of the aromatic ring. This compound is typically encountered as a white to off-white solid and is soluble in water, which enhances its utility in various applications. As a sodium salt, it exhibits properties typical of ionic compounds, including higher melting points compared to their acid counterparts. The presence of chlorine substituents can influence its reactivity and biological activity, making it of interest in fields such as pharmaceuticals and agrochemicals. Additionally, it may serve as a preservative or antimicrobial agent due to the inherent properties of benzoic acid derivatives. Safety data indicates that, while it may pose some hazards, it is generally considered to have low toxicity, although appropriate handling and safety measures should always be observed.
Formula:C7H4Cl2O2·Na
InChI:InChI=1S/C7H4Cl2O2.Na/c8-4-2-1-3-5(9)6(4)7(10)11;/h1-3H,(H,10,11);
InChI key:InChIKey=HVEUGAWTRITTLQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=CC=C1Cl.[Na]
Synonyms:
  • Sodium 2,6-dichlorobenzoate
  • Benzoic acid, 2,6-dichloro-, sodium salt (1:1)
  • Benzoic acid, 2,6-dichloro-, sodium salt
Found 4 products.