CAS 100073-15-2
:tributyl(1-methylethenyl)stannane
Description:
Tributyl(1-methylethenyl)stannane, with the CAS number 100073-15-2, is an organotin compound characterized by the presence of a tin atom bonded to three butyl groups and one 1-methylethenyl group. This compound typically exhibits a colorless to pale yellow liquid form and is known for its relatively low volatility. Organotin compounds like tributyl(1-methylethenyl)stannane are often utilized in various applications, including as intermediates in organic synthesis and as stabilizers in polymer production. The presence of the tin atom imparts unique reactivity, allowing for participation in various chemical reactions, such as nucleophilic substitutions. Additionally, the butyl groups contribute to its hydrophobic nature, influencing its solubility in organic solvents. However, it is important to note that organotin compounds can pose environmental and health risks, leading to regulatory scrutiny. Proper handling and disposal practices are essential to mitigate potential hazards associated with this substance.
Formula:C15H32Sn
InChI:InChI=1/3C4H9.C3H5.Sn/c3*1-3-4-2;1-3-2;/h3*1,3-4H2,2H3;1H2,2H3;/rC15H32Sn/c1-6-9-12-16(15(4)5,13-10-7-2)14-11-8-3/h4,6-14H2,1-3,5H3
InChI key:PUMSLVXNEXVCIC-UHFFFAOYSA-N
SMILES:CCCC[Sn](CCCC)(CCCC)C(=C)C
Synonyms:- Stannane, tributyl(1-methylethenyl)-
- Tributyl(prop-1-en-2-yl)stannane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Stannane, tributyl(1-methylethenyl)-
CAS:Formula:C15H32SnPurity:98%Color and Shape:LiquidMolecular weight:331.11562-(Tributylstannyl)propene
CAS:Controlled Product2-(Tributylstannyl)propene (2-TBTP) is a cardiac muscle relaxant that inhibits the activity of the leukocyte ryanodine receptor. It has been shown to be effective in reducing nasal congestion, and is used for treating post-myocardial infarction. 2-TBTP also prevents the release of intracellular calcium ions from sarcoplasmic reticulum in cardiac muscle cells and has been shown to reduce concentrations of cholesterol, triglycerides, and phospholipids in the blood. 2-TBTP inhibits post-infarction remodeling by inhibiting fibroblast proliferation and collagen synthesis. This agent has also been shown to have chemotactic effects on neutrophils and eosinophils.Formula:C15H32SnPurity:Min. 95%Molecular weight:331.12 g/mol

