CymitQuimica logo

CAS 1000783-73-2

:

Benzenemethanol, 2,4-dimethyl-α-(trifluoromethyl)-

Description:
Benzenemethanol, 2,4-dimethyl-α-(trifluoromethyl)-, also known by its CAS number 1000783-73-2, is an organic compound characterized by a benzene ring substituted with a hydroxymethyl group, two methyl groups at the 2 and 4 positions, and a trifluoromethyl group at the alpha position relative to the hydroxymethyl group. This compound typically exhibits a colorless to pale yellow liquid form and possesses a distinctive aromatic odor. Its molecular structure contributes to its unique chemical properties, including moderate polarity due to the hydroxymethyl group and significant electron-withdrawing effects from the trifluoromethyl group, which can influence its reactivity and solubility in various solvents. The presence of multiple functional groups allows for potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as the trifluoromethyl group can impart specific toxicity and environmental considerations.
Formula:C10H11F3O
InChI:InChI=1S/C10H11F3O/c1-6-3-4-8(7(2)5-6)9(14)10(11,12)13/h3-5,9,14H,1-2H3
InChI key:JRWQOLMAHKQNNF-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)C(C(F)(F)F)O)C
Synonyms:
  • 1-(2,4-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol - [D92570]
  • 1-(2,4-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol
  • Benzenemethanol, 2,4-dimethyl-α-(trifluoromethyl)-
Found 3 products.