CAS 100079-22-9
:Benzamide, 3,4,5-trihydroxy-N-pentyl-
Description:
Benzamide, 3,4,5-trihydroxy-N-pentyl- is an organic compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (amide) and a pentyl substituent. The presence of three hydroxyl (-OH) groups at the 3, 4, and 5 positions of the benzene ring indicates that it is a polyhydroxy compound, which can influence its solubility and reactivity. The pentyl group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological systems and solvents. This compound may exhibit various biological activities due to the hydroxyl groups, which can participate in hydrogen bonding and enhance its solubility in polar solvents. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, making it of interest in medicinal chemistry and materials science. Its CAS number, 100079-22-9, allows for precise identification in chemical databases, facilitating research and application in various fields.
Formula:C12H17NO4
InChI:InChI=1S/C12H17NO4/c1-2-3-4-5-13-12(17)8-6-9(14)11(16)10(15)7-8/h6-7,14-16H,2-5H2,1H3,(H,13,17)
InChI key:InChIKey=YHAIVSVLSAOHGF-UHFFFAOYSA-N
SMILES:C(NCCCCC)(=O)C1=CC(O)=C(O)C(O)=C1
Synonyms:- 3,4,5-Trihydroxy-N-pentylbenzamide
- Benzamide, 3,4,5-trihydroxy-N-pentyl-
Sort by
Found 1 products.
