CymitQuimica logo

CAS 100079-26-3

:

1-(3,4,5-trihydroxyphenyl)nonan-1-one

Description:
1-(3,4,5-trihydroxyphenyl)nonan-1-one, also known by its CAS number 100079-26-3, is an organic compound characterized by a nonanone backbone with a phenolic substituent. This compound features a long aliphatic chain (nonane) attached to a ketone functional group at one end and a phenolic group with three hydroxyl (-OH) groups at the 3, 4, and 5 positions on the aromatic ring. The presence of multiple hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity in various chemical reactions, including oxidation and esterification. The phenolic structure suggests potential antioxidant properties, which could be of interest in biochemical applications. Additionally, the compound may exhibit biological activity, making it relevant in fields such as medicinal chemistry and natural product research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C15H22O4
InChI:InChI=1/C15H22O4/c1-2-3-4-5-6-7-8-12(16)11-9-13(17)15(19)14(18)10-11/h9-10,17-19H,2-8H2,1H3
InChI key:NVFRHTFJDGAFQS-UHFFFAOYSA-N
SMILES:CCCCCCCCC(=O)c1cc(c(c(c1)O)O)O
Found 3 products.