CymitQuimica logo

CAS 100079-39-8

:

2-Propen-1-one,1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-(2-methoxyphenyl)-, (E)- (9CI)

Description:
2-Propen-1-one, 1-(2,4-dihydroxy-3,6-dimethoxyphenyl)-3-(2-methoxyphenyl)-, (E)-, commonly referred to by its CAS number 100079-39-8, is an organic compound characterized by its conjugated double bond system and multiple functional groups. This compound features a propenone backbone, which is indicative of its reactivity and potential applications in organic synthesis. The presence of hydroxyl (-OH) and methoxy (-OCH3) groups on the aromatic rings contributes to its polarity and solubility in various solvents, influencing its chemical behavior and interactions. The (E)- configuration denotes the specific geometric arrangement of substituents around the double bond, which can affect its biological activity and reactivity. This compound may exhibit antioxidant properties due to the presence of hydroxyl groups, making it of interest in pharmaceutical and cosmetic applications. Additionally, its structural complexity suggests potential for various synthetic modifications, which could lead to derivatives with enhanced properties or activities. Overall, this compound represents a unique structure with potential utility in multiple fields of chemistry.
Formula:C18H18O6
InChI:InChI=1S/C18H18O6/c1-22-14-7-5-4-6-11(14)8-9-12(19)16-15(23-2)10-13(20)18(24-3)17(16)21/h4-10,20-21H,1-3H3/b9-8+
InChI key:CRKKMWPCJTZZRE-CMDGGOBGSA-N
SMILES:COC1=CC=CC=C1/C=C/C(=O)C2=C(C=C(C(=C2O)OC)O)OC
Found 4 products.