
CAS 10008-75-0
:rel-(2R,3R)-2,3-Dimercaptobutanedioic acid
Description:
Rel-(2R,3R)-2,3-Dimercaptobutanedioic acid, commonly known as DMBA, is a chemical compound characterized by the presence of two thiol (-SH) groups and a dicarboxylic acid structure. This compound features a four-carbon backbone with two carboxylic acid functional groups at each end and two mercapto groups attached to the second and third carbon atoms. The stereochemistry of DMBA is significant, as it possesses specific chiral centers that contribute to its biological activity and reactivity. DMBA is known for its chelating properties, allowing it to bind metal ions, which can be useful in various applications, including biochemistry and environmental science. Additionally, its thiol groups make it a potential candidate for antioxidant activity, as thiols can readily donate electrons. The compound is typically handled with care due to the reactivity of its thiol groups, which can undergo oxidation or participate in various chemical reactions. Overall, DMBA is a versatile compound with potential applications in medicinal chemistry and metal ion remediation.
Formula:C4H6O4S2
InChI:InChI=1/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/t1-,2-/s2
InChI key:InChIKey=ACTRVOBWPAIOHC-FNNSSLBKNA-N
SMILES:[C@H]([C@@H](C(O)=O)S)(C(O)=O)S
Synonyms:- Butanedioic acid, 2,3-dimercapto-, (2R,3R)-rel-
- Succinic acid, 2,3-dimercapto-, (±)-
- Butanedioic acid, 2,3-dimercapto-, (R*,R*)-(±)-
- DL-Dimercaptosuccinic acid
- rel-(2R,3R)-2,3-Dimercaptobutanedioic acid
Sort by
Found 1 products.
rac-2,3-Dimercaptosuccinic Acid
CAS:Controlled ProductFormula:C4H6O4S2Color and Shape:NeatMolecular weight:182.22
