CymitQuimica logo

CAS 100080-03-3

:

4-(Trimethoxysilyl)-1-butanethiol

Description:
4-(Trimethoxysilyl)-1-butanethiol, with the CAS number 100080-03-3, is an organosilicon compound characterized by the presence of both thiol and silane functional groups. This compound typically appears as a colorless to pale yellow liquid and is known for its ability to bond to various substrates, making it useful in surface modification and adhesion applications. The trimethoxysilyl group enhances its reactivity with siliceous surfaces, while the butanethiol moiety provides thiol functionality, which can form strong covalent bonds with metals and other materials. This dual functionality allows it to serve as a coupling agent in composites, improving the mechanical properties and durability of materials. Additionally, it exhibits good compatibility with organic solvents and can be used in formulations for coatings, adhesives, and sealants. Its reactivity with moisture can lead to the formation of siloxane networks, contributing to its utility in various industrial applications. Proper handling and storage are essential due to its potential reactivity and the presence of thiol groups, which can be sensitive to oxidation.
Formula:C7H18O3SSi
InChI:InChI=1S/C7H18O3SSi/c1-8-12(9-2,10-3)7-5-4-6-11/h11H,4-7H2,1-3H3
InChI key:InChIKey=LMAFAQBMCIYHQS-UHFFFAOYSA-N
SMILES:[Si](CCCCS)(OC)(OC)OC
Synonyms:
  • 4-(Trimethoxysilyl)-1-butanethiol
  • 4-Mercaptobutyltrimethoxysilane
  • 1-Butanethiol, 4-(trimethoxysilyl)-
Sort by

Found 1 products.