CymitQuimica logo

CAS 1000802-75-4

:

B-(2-Methoxy-6-methyl-3-pyridinyl)boronic acid

Description:
B-(2-Methoxy-6-methyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the methoxy group, which enhances its reactivity and interaction with various substrates. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. Additionally, the methyl and methoxy substituents on the pyridine ring can influence the electronic properties and steric hindrance, affecting its reactivity and selectivity in chemical reactions. This compound may also exhibit biological activity, as boronic acids are known to interact with certain enzymes and receptors. Overall, B-(2-Methoxy-6-methyl-3-pyridinyl)boronic acid is a versatile compound with applications in both synthetic organic chemistry and potentially in medicinal chemistry.
Formula:C7H10BNO3
InChI:InChI=1S/C7H10BNO3/c1-5-3-4-6(8(10)11)7(9-5)12-2/h3-4,10-11H,1-2H3
InChI key:InChIKey=FPYWLOGLINZGBB-UHFFFAOYSA-N
SMILES:O(C)C1=C(B(O)O)C=CC(C)=N1
Synonyms:
  • (6-Methyl-2-methoxypyridin-3-yl)boronic acid
  • 2-Methoxy-6-methylpyridine-3-boronic acid
  • (2-Methoxy-6-methylpyridin-3-yl)boronic acid
  • B-(2-Methoxy-6-methyl-3-pyridinyl)boronic acid
  • Boronic acid, B-(2-methoxy-6-methyl-3-pyridinyl)-
Found 5 products.