CymitQuimica logo

CAS 1000895-26-0

:

5-Amino-1H-pyrazole-3-methanol

Description:
5-Amino-1H-pyrazole-3-methanol is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the pyrazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxymethyl group. The compound may exhibit various properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its reactivity can be influenced by the amino and hydroxymethyl groups, allowing for further derivatization. As with many nitrogen-containing heterocycles, it may also display interesting coordination chemistry with metal ions. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C4H7N3O
InChI:InChI=1S/C4H7N3O/c5-4-1-3(2-8)6-7-4/h1,8H,2H2,(H3,5,6,7)
InChI key:InChIKey=NZORXPUYHVZTQG-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(N)NN1
Synonyms:
  • (3-Amino-1H-pyrazol-5-yl)methanol
  • 3-Amino-5-hydroxymethyl-1H-pyrazole
  • 5-Amino-1H-pyrazole-3-methanol
  • 1H-Pyrazole-3-methanol, 5-amino-
  • (5-Amino-1H-pyrazol-3-yl)methanol
Found 3 products.