CymitQuimica logo

CAS 1000922-53-1

:

Benzenemethanamine,2-chloro-6-fluoro-a-methyl-, (aS)-

Description:
Benzenemethanamine, 2-chloro-6-fluoro-α-methyl-, (αS)-, also known by its CAS number 1000922-53-1, is a chiral organic compound characterized by the presence of an amine functional group attached to a benzene ring. This compound features a chloro and a fluoro substituent on the aromatic ring, which can influence its reactivity and physical properties. The α-methyl group indicates that there is a methyl group adjacent to the amine, contributing to its stereochemistry. As a chiral molecule, it exists in two enantiomeric forms, which can exhibit different biological activities and interactions. The presence of halogen atoms (chlorine and fluorine) typically enhances the lipophilicity of the compound, potentially affecting its solubility and permeability in biological systems. Such compounds are often of interest in medicinal chemistry and drug development due to their potential pharmacological properties. Safety and handling precautions should be observed, as with many amines and halogenated compounds, due to their possible toxicity and environmental impact.
Formula:C8H9ClFN
InChI:InChI=1S/C8H9ClFN/c1-5(11)8-6(9)3-2-4-7(8)10/h2-5H,11H2,1H3
InChI key:WLQXZWHHERXWHA-UHFFFAOYSA-N
SMILES:CC(C1=C(C=CC=C1Cl)F)N
Found 4 products.