CymitQuimica logo

CAS 1000931-98-5

:

5-(Aminocarbonyl)-1-methyl-1H-pyrrole-3-sulfonyl chloride

Description:
5-(Aminocarbonyl)-1-methyl-1H-pyrrole-3-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with an aminocarbonyl group and a sulfonyl chloride functional group. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the sulfonyl chloride group makes it a reactive intermediate, allowing it to form sulfonamides or other derivatives upon reaction with amines or alcohols. Additionally, the compound's solubility in polar solvents and its stability under certain conditions are important characteristics that influence its handling and application in laboratory settings. Safety precautions should be observed when working with this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon hydrolysis. Overall, its reactivity and structural features make it a valuable compound in synthetic organic chemistry.
Formula:C6H7ClN2O3S
InChI:InChI=1S/C6H7ClN2O3S/c1-9-3-4(13(7,11)12)2-5(9)6(8)10/h2-3H,1H3,(H2,8,10)
InChI key:InChIKey=AXBOCAUMNPHCFS-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C(C(N)=O)N(C)C1
Synonyms:
  • 5-(Aminocarbonyl)-1-methyl-1H-pyrrole-3-sulfonyl chloride
  • 1H-Pyrrole-3-sulfonyl chloride, 5-(aminocarbonyl)-1-methyl-
Found 1 products.