CymitQuimica logo

CAS 1000932-10-4

:

1-(4-Fluorophenyl)-2-(1,3,4-thiadiazol-2-ylthio)ethanone

Description:
1-(4-Fluorophenyl)-2-(1,3,4-thiadiazol-2-ylthio)ethanone, identified by its CAS number 1000932-10-4, is a chemical compound characterized by its unique structural features, which include a fluorophenyl group and a thiadiazole moiety. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of the fluorine atom, which can influence its biological activity and solubility properties. The thiadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. The compound may display properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its synthesis involves standard organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Safety and handling considerations are essential, as with many organic compounds, to mitigate any potential hazards associated with its use in research or industrial applications.
Formula:C10H7FN2OS2
InChI:InChI=1S/C10H7FN2OS2/c11-8-3-1-7(2-4-8)9(14)5-15-10-13-12-6-16-10/h1-4,6H,5H2
InChI key:InChIKey=RQMOFJZHBYMLDP-UHFFFAOYSA-N
SMILES:C(CSC1=NN=CS1)(=O)C2=CC=C(F)C=C2
Synonyms:
  • Ethanone, 1-(4-fluorophenyl)-2-(1,3,4-thiadiazol-2-ylthio)-
  • 1-(4-Fluorophenyl)-2-(1,3,4-thiadiazol-2-ylthio)ethanone
Found 1 products.