CymitQuimica logo

CAS 1000932-31-9

:

4-Phenyl-1-(phenylmethyl)-1H-imidazol-5-amine

Description:
4-Phenyl-1-(phenylmethyl)-1H-imidazol-5-amine, identified by its CAS number 1000932-31-9, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a phenyl group and a benzyl group attached to the imidazole, contributing to its aromatic properties. The presence of the amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with various biological targets, which could lead to applications in pharmaceuticals. Additionally, the compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and the environment in which it is studied. Overall, 4-Phenyl-1-(phenylmethyl)-1H-imidazol-5-amine represents a class of compounds that may have significant implications in chemical and biological research.
Formula:C16H15N3
InChI:InChI=1S/C16H15N3/c17-16-15(14-9-5-2-6-10-14)18-12-19(16)11-13-7-3-1-4-8-13/h1-10,12H,11,17H2
InChI key:InChIKey=XROJJZRAHMZJLE-UHFFFAOYSA-N
SMILES:NC1=C(N=CN1CC2=CC=CC=C2)C3=CC=CC=C3
Synonyms:
  • 4-Phenyl-1-(phenylmethyl)-1H-imidazol-5-amine
  • 1H-Imidazol-5-amine, 4-phenyl-1-(phenylmethyl)-
Found 1 products.