CymitQuimica logo

CAS 1000932-34-2

:

Isoxazole,5-methyl-3-(2-pyrrolidinyl)-

Description:
Isoxazole, 5-methyl-3-(2-pyrrolidinyl)- is a heterocyclic organic compound characterized by the presence of an isoxazole ring, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. The compound features a methyl group at the 5-position of the isoxazole ring and a pyrrolidine moiety at the 3-position, contributing to its structural complexity and potential biological activity. Isoxazoles are known for their diverse pharmacological properties, including anti-inflammatory and analgesic effects. The presence of the pyrrolidine group may enhance the compound's lipophilicity and ability to cross biological membranes, potentially influencing its interaction with various biological targets. This compound's unique structure may also lead to specific reactivity patterns, making it of interest in medicinal chemistry and drug development. As with many heterocycles, the stability and reactivity of isoxazole derivatives can be influenced by substituents and the electronic environment, which may affect their applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-6-5-8(10-11-6)7-3-2-4-9-7/h5,7,9H,2-4H2,1H3
InChI key:QHCHHBRSMFGRQX-UHFFFAOYSA-N
SMILES:CC1=CC(=NO1)C2CCCN2
Found 2 products.