CAS 1000932-35-3
:3-Bromopyrimido[1,2-a]benzimidazole
Description:
3-Bromopyrimido[1,2-a]benzimidazole is a heterocyclic compound characterized by the presence of both a bromine atom and a fused pyrimidine-benzimidazole structure. This compound typically exhibits a pale to dark solid appearance, depending on its purity and form. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine substituent can influence its reactivity and interaction with biological targets. The compound may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. Its molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Additionally, it may show fluorescence properties, which can be useful in analytical applications. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Always refer to safety data sheets and conduct thorough risk assessments when working with such compounds.
Formula:C10H6BrN3
InChI:InChI=1S/C10H6BrN3/c11-7-5-12-10-13-8-3-1-2-4-9(8)14(10)6-7/h1-6H
InChI key:InChIKey=VEXDSLZOKLRXIT-UHFFFAOYSA-N
SMILES:BrC1=CN2C=3C(N=C2N=C1)=CC=CC3
Synonyms:- 3-Bromobenzo[4,5]imidazo[1,2-a]pyrimidine
- 3-Bromopyrimido[1,2-a]benzimidazole
- Pyrimido[1,2-a]benzimidazole, 3-bromo-
Sort by
Found 1 products.
12-bromo-1,8,10-triazatricyclo[7.4.0.0,2,7]trideca-2,4,6,8,10,12-hexaene
CAS:Formula:C10H6BrN3Molecular weight:248.0787
