CAS 1000932-54-6: 4-[(Cyclopropylamino)sulfonyl]benzenesulfonyl chloride

Description: 4-[(Cyclopropylamino)sulfonyl]benzenesulfonyl chloride is a chemical compound characterized by its sulfonamide functional groups, which contribute to its reactivity and potential applications in medicinal chemistry. The presence of the cyclopropylamino group introduces unique steric and electronic properties, making it an interesting candidate for drug development. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its ability to participate in nucleophilic substitution reactions due to the presence of the sulfonyl chloride moiety. It is soluble in polar organic solvents, which facilitates its use in various synthetic pathways. The compound's reactivity can be attributed to the electrophilic nature of the sulfonyl chloride, allowing it to react with nucleophiles, including amines and alcohols, to form sulfonamides or other derivatives. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, its unique structure and reactivity make it a valuable compound in organic synthesis and pharmaceutical research.

Formula: C₉H₁₀ClNO₄S₂

InChI: InChI=1S/C9H10ClNO4S2/c10-16(12,13)8-3-5-9(6-4-8)17(14,15)11-7-1-2-7/h3-7,11H,1-2H2

InChI key: InChIKey=IKRLTAZGFZYUGS-UHFFFAOYSA-N

SMILES: O=S(=O)(Cl)C1=CC=C(C=C1)S(=O)(=O)NC2CC2

Synonyms:

• Benzenesulfonyl chloride, 4-[(cyclopropylamino)sulfonyl]-
• 4-[(Cyclopropylamino)sulfonyl]benzenesulfonyl chloride

4-(Cyclopropylsulfamoyl)benzene-1-sulfonyl chloride

CAS: 1000932-54-6

Versatile small molecule scaffold

• Formula: C₉H₁₀ClNO₄S₂
• Purity: Min. 95%
• Molecular weight: 295.8 g/mol

4-(Cyclopropylsulfamoyl)benzene-1-sulfonyl chloride

CAS: 1000932-54-6

• Purity: 95%
• Molecular weight: 295.75