CymitQuimica logo

CAS 1001-19-0

:

D-Glutamicacid, diethyl ester, hydrochloride (9CI)

Description:
D-Glutamic acid, diethyl ester, hydrochloride (9CI) is a chemical compound characterized by its structure as a diethyl ester of D-glutamic acid, which is an amino acid that plays a crucial role in various biological processes. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water. This substance typically appears as a white to off-white crystalline powder. It is known for its potential applications in pharmaceuticals, particularly in the synthesis of various bioactive compounds. The presence of the diethyl ester group suggests that it may exhibit properties related to esterification, such as increased lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, D-glutamic acid is involved in neurotransmission and metabolic pathways, making its derivatives of interest in research related to neurochemistry and metabolic disorders. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H17NO4・ClH
InChI:InChI=1S/C9H17NO4.ClH/c1-3-13-8(11)6-5-7(10)9(12)14-4-2;/h7H,3-6,10H2,1-2H3;1H/t7-;/m1./s1
InChI key:WSEQLMQNPBNMSL-OGFXRTJISA-N
SMILES:CCOC(=O)CC[C@H](C(=O)OCC)N.Cl
Synonyms:
  • Glutamicacid, diethyl ester, hydrochloride, D- (8CI)
  • Diethyl D-glutamate hydrochloride
  • Nsc 114914
Found 6 products.