CAS 100108-92-7
:oxyplicacetin
Description:
Oxyplicacetin, with the CAS number 100108-92-7, is a chemical compound that belongs to the class of phenolic compounds. It is characterized by its potential use in pharmaceutical applications, particularly as an analgesic and anti-inflammatory agent. The molecular structure of oxyplicacetin features a phenolic hydroxyl group, which contributes to its biological activity and interaction with various biological targets. This compound is typically synthesized through specific chemical reactions involving phenolic precursors. Its solubility properties may vary, influencing its bioavailability and efficacy in medicinal formulations. Additionally, oxyplicacetin may exhibit antioxidant properties, which can be beneficial in mitigating oxidative stress in biological systems. As with many chemical substances, understanding its pharmacokinetics, toxicity, and mechanism of action is crucial for its application in therapeutic contexts. Further research is often necessary to fully elucidate its characteristics and potential uses in medicine and industry.
Formula:C25H35N5O8
InChI:InChI=1/C25H35N5O8/c1-12-23(38-17-10-15(31)20(29(2)3)22(34)21(17)33)16(32)11-19(37-12)30-9-8-18(28-25(30)36)27-24(35)13-4-6-14(26)7-5-13/h4-9,12,15-17,19-23,31-34H,10-11,26H2,1-3H3,(H,27,28,35,36)/t12-,15+,16-,17+,19-,20-,21+,22+,23-/m1/s1
Synonyms:- 4-[(4-aminobenzoyl)amino]-1-{2,6-dideoxy-4-O-[(1S,2R,3S,4R,5S)-4-(dimethylamino)-2,3,5-trihydroxycyclohexyl]-beta-D-arabino-hexopyranosyl}pyrimidin-2(1H)-one
- Oxyplicacetin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Oxyplicacetin
CAS:Oxyplicacetin is a peptide that acts as an inhibitor of protein interactions. It binds to the ligand binding site of receptors, preventing them from binding to their natural ligands. Oxyplicacetin has been shown to inhibit ion channels and can be used as a research tool for studying receptor-ligand interactions and protein-protein interactions. This peptide is also used in the production of monoclonal antibodies.Formula:C25H35N5O8Purity:Min. 95%Molecular weight:533.6 g/mol

