
CAS 1001096-10-1
:2-Fluoro-6-trifluoromethylbenzyl chloride
Description:
2-Fluoro-6-trifluoromethylbenzyl chloride is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom at the 2-position and a trifluoromethyl group at the 6-position, along with a benzyl chloride functional group. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the presence of fluorine atoms often imparts unique electronic properties, affecting the compound's stability and reactivity. Safety precautions are necessary when handling this substance, as it may pose health risks and environmental hazards. Overall, 2-Fluoro-6-trifluoromethylbenzyl chloride is a valuable compound in synthetic organic chemistry, particularly in the development of pharmaceuticals and specialty chemicals.
Formula:C8H5ClF4
InChI:InChI=1S/C8H5ClF4/c9-4-5-6(8(11,12)13)2-1-3-7(5)10/h1-3H,4H2
InChI key:NVMNTWHOSXLNKZ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)F)CCl)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
