CymitQuimica logo

CAS 100114-24-7

:

5-METHYL-2-METHYLSULFANYL-PYRIMIDINE

Description:
5-Methyl-2-methylsulfanylpyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a methyl group at the 5-position and a methylsulfanyl group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in polar organic solvents and exhibits moderate stability under standard conditions. The methylsulfanyl group imparts distinct reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, its structural features may influence its biological activity, making it of interest in pharmaceutical research. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C6H8N2S
InChI:InChI=1/C6H8N2S/c1-5-3-7-6(9-2)8-4-5/h3-4H,1-2H3
InChI key:HMROJJZKKIPDRB-UHFFFAOYSA-N
SMILES:Cc1cnc(nc1)SC
Synonyms:
  • Pyrimidine, 5-methyl-2-(methylthio)-
  • 5-Methyl-2-(Methylthio)Pyrimidine
Found 3 products.