CymitQuimica logo

CAS 100119-45-7

:

4-phenyltetrahydropyran-4-carbonyl chloride

Description:
4-Phenyltetrahydropyran-4-carbonyl chloride, with the CAS number 100119-45-7, is an organic compound characterized by its unique structure that includes a tetrahydropyran ring substituted with a phenyl group and a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the carbonyl chloride group, which can participate in nucleophilic acyl substitution reactions, making it useful in organic synthesis, particularly in the formation of amides or esters. The tetrahydropyran moiety contributes to its cyclic structure, influencing its physical properties such as boiling point and solubility. Additionally, the phenyl group can affect the compound's electronic properties and reactivity. As with many carbonyl chlorides, it may be sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper safety precautions are essential when working with this compound due to its potential hazards.
Formula:C12H13ClO2
InChI:InChI=1/C12H13ClO2/c13-11(14)12(6-8-15-9-7-12)10-4-2-1-3-5-10/h1-5H,6-9H2
InChI key:MNCVQLSKZIVCDW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1(CCOCC1)C(=O)Cl
Synonyms:
  • 4-Phenyltetrahydro-2H-pyran-4-carbonyl chloride
  • 4-phenyltetrahydropyran-4-carbonyl chloride
  • 4-(Chlorocarbonyl)-4-phenyltetrahydro-2H-pyran, [4-(Chlorocarbonyl)tetrahydro-2H-pyran-4-yl]benzene
  • 2H-Pyran-4-carbonyl chloride, tetrahydro-4-phenyl-
Found 3 products.