CymitQuimica logo

CAS 100121-80-0

:

cyclobutyl(4-methoxyphenyl)methanone

Description:
Cyclobutyl(4-methoxyphenyl)methanone, with the CAS number 100121-80-0, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a 4-methoxyphenyl moiety attached to a carbonyl functional group. This compound typically exhibits properties common to ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclobutyl and aromatic components. The presence of the methoxy group enhances its electron-donating properties, which can influence its reactivity and interactions in chemical reactions. Cyclobutyl(4-methoxyphenyl)methanone may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in the development of pharmaceuticals or as an intermediate in chemical reactions. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c1-14-11-7-5-10(6-8-11)12(13)9-3-2-4-9/h5-9H,2-4H2,1H3
InChI key:ZFYOOJLCJQTVHL-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)C(=O)C1CCC1
Found 3 products.