
CAS 100125-96-0
:Ethyl 3-bromo-4-methoxyphenylacetate
Description:
Ethyl 3-bromo-4-methoxyphenylacetate is an organic compound characterized by its ester functional group, which is derived from the reaction of phenolic and acetic acid components. It features a bromine atom and a methoxy group attached to a phenyl ring, contributing to its unique reactivity and properties. The presence of the bromine atom typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group can influence the compound's solubility and polarity, often making it more soluble in organic solvents. Ethyl 3-bromo-4-methoxyphenylacetate is generally used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure allows for potential applications in medicinal chemistry, where modifications can lead to the discovery of new therapeutic agents. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound exemplifies the diverse functionalities that can be achieved through careful molecular design in organic synthesis.
Formula:C11H13BrO3
InChI:InChI=1S/C11H13BrO3/c1-3-15-11(13)7-8-4-5-10(14-2)9(12)6-8/h4-6H,3,7H2,1-2H3
InChI key:YMZZEMPQYJBPFT-UHFFFAOYSA-N
SMILES:CCOC(=O)CC1=CC(=C(C=C1)OC)Br
Synonyms:- Ethyl 3-broMo-4-Methoxyphenylacetate
- 3-Bromo-4-methoxybenzeneacetic acid ethyl ester
- 3-Bromo-4-methoxyphenylacetic acid ethyl ester
- Ethyl 2-(3-bromo-4-methoxyphenyl)acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2-(3-bromo-4-methoxyphenyl)acetate
CAS:Ethyl 2-(3-bromo-4-methoxyphenyl)acetateFormula:C11H13BrO3Purity:95%Molecular weight:273.13Ethyl 2-(3-Bromo-4-Methoxyphenyl)Acetate
CAS:Formula:C11H13BrO3Purity:95%Color and Shape:LiquidMolecular weight:273.12313-Bromo-4-methoxyphenylacetic acid ethyl ester
CAS:3-Bromo-4-methoxyphenylacetic acid ethyl ester is a versatile building block that can be used to synthesize a variety of compounds. It is also a useful intermediate for research chemicals and pharmaceuticals. 3-Bromo-4-methoxyphenylacetic acid ethyl ester is a fine chemical with high quality and can be used as a reagent or speciality chemical. As a reaction component, this product makes an excellent scaffold for complex compounds.Formula:C11H13BrO3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:273.12 g/mol




