CymitQuimica logo

CAS 1001346-86-6

:

4-amino-5-chloro-2-fluorobenzoic acid

Description:
4-Amino-5-chloro-2-fluorobenzoic acid is an aromatic compound characterized by the presence of an amino group, a chloro substituent, and a fluoro substituent on a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The amino group (-NH2) is typically a strong electron-donating group, influencing the compound's reactivity and solubility in polar solvents. The presence of chlorine and fluorine atoms introduces electronegative elements that can affect the compound's overall polarity and potential for hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including potential hydrogen bonding and dipole-dipole interactions, which can influence its behavior in different chemical environments. Additionally, the compound's stability and reactivity can be influenced by the positions of the substituents on the benzene ring, which can affect its synthesis and application in various chemical processes.
Formula:C7H5ClFNO2
InChI:InChI=1S/C7H5ClFNO2/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2H,10H2,(H,11,12)
InChI key:UBVUOMYWOMBBGJ-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1Cl)N)F)C(=O)O
Found 1 products.