CymitQuimica logo

CAS 1001354-10-4

:

L-Proline, 4-methoxy-, hydrochloride (1:1), (4R)-

Description:
L-Proline, 4-methoxy-, hydrochloride (1:1), (4R)- is a chemical compound characterized by its structure as a derivative of the amino acid proline, featuring a methoxy group at the 4-position of the pyrrolidine ring. This compound exists as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in biochemical and pharmaceutical contexts. The (4R) designation indicates the specific stereochemistry of the molecule, which is crucial for its biological activity. L-Proline itself is known for its role in protein synthesis and as a precursor for various bioactive compounds. The presence of the methoxy group may influence the compound's properties, such as its reactivity and interaction with biological systems. Overall, L-Proline, 4-methoxy-, hydrochloride is of interest in research related to medicinal chemistry, particularly in the development of therapeutic agents and understanding metabolic pathways involving proline derivatives.
Formula:C6H11NO3·ClH
InChI:InChI=1S/C6H11NO3.ClH/c1-10-4-2-5(6(8)9)7-3-4;/h4-5,7H,2-3H2,1H3,(H,8,9);1H/t4-,5+;/m1./s1
InChI key:InChIKey=OZLHSLSQWWKSAL-JBUOLDKXSA-N
SMILES:C(O)(=O)[C@@H]1C[C@@H](OC)CN1.Cl
Synonyms:
  • L-Proline, 4-methoxy-, hydrochloride (1:1), (4R)-
Found 2 products.