
CAS 1001354-57-9
:(3R)-1-Cyclopropyl-3-piperidinamine
Description:
(3R)-1-Cyclopropyl-3-piperidinamine is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropyl group attached to a piperidine ring. This compound features a chiral center at the 3-position of the piperidine, contributing to its stereochemical properties. The presence of the cyclopropyl moiety can influence the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Typically, compounds like this may exhibit properties such as moderate to high solubility in organic solvents and potential bioactivity, which can be explored in pharmacological studies. The amine functional group suggests that it may participate in hydrogen bonding, affecting its pharmacokinetics and pharmacodynamics. Overall, (3R)-1-Cyclopropyl-3-piperidinamine's structural features position it as a candidate for further research in drug development, particularly in areas targeting central nervous system disorders or other therapeutic applications.
Formula:C8H16N2
InChI:InChI=1S/C8H16N2/c9-7-2-1-5-10(6-7)8-3-4-8/h7-8H,1-6,9H2/t7-/m1/s1
InChI key:InChIKey=NDISUUBHSUMXEW-SSDOTTSWSA-N
SMILES:N[C@H]1CN(CCC1)C2CC2
Synonyms:- (3R)-1-Cyclopropyl-3-piperidinamine
- (3R)-1-Cyclopropylpiperidin-3-amine
- 3-Piperidinamine, 1-cyclopropyl-, (3R)-
Sort by
Found 1 products.
(3R)-1-Cyclopropyl-3-piperidinamine Hydrochloride
CAS:Controlled ProductFormula:C8H16N2•x(HCl)Color and Shape:NeatMolecular weight:140.23 + x(46.36)
