CymitQuimica logo

CAS 100137-47-1

:

2-Pyridinecarboxamide,4-amino-(9CI)

Description:
2-Pyridinecarboxamide, 4-amino- (9CI), also known by its CAS number 100137-47-1, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amide functional group and an amino group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of the amino group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds like this can exhibit various properties such as moderate to high melting points and stability under standard conditions. They may also participate in hydrogen bonding due to the presence of both the amide and amino groups, which can affect their reactivity and interactions with other molecules. 2-Pyridinecarboxamide, 4-amino- may be of interest in pharmaceutical research, particularly for its potential applications in drug development or as a ligand in coordination chemistry.
Formula:C6H7N3O
InChI:InChI=1S/C6H7N3O/c7-4-1-2-9-5(3-4)6(8)10/h1-3H,(H2,7,9)(H2,8,10)
InChI key:QKNCZYUYGMWQPB-UHFFFAOYSA-N
SMILES:C1=CN=C(C=C1N)C(=O)N
Found 5 products.