CymitQuimica logo

CAS 1001412-41-4

:

5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine

Description:
5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two chlorine substituents at the 5 and 7 positions of the pyrrolo ring, enhancing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Due to its structural characteristics, 5,7-Dichloro-1H-pyrrolo[2,3-c]pyridine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization are of interest in research settings, where its potential as a building block for more complex molecules is explored. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C7H4Cl2N2
InChI:InChI=1S/C7H4Cl2N2/c8-5-3-4-1-2-10-6(4)7(9)11-5/h1-3,10H
InChI key:OALVDHPNAWHICK-UHFFFAOYSA-N
SMILES:c1c[nH]c2c1cc(Cl)nc2Cl
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine, 5,7-dichloro-
  • 5,7-Dichloro-6-azaindole
Found 5 products.