CymitQuimica logo

CAS 1001413-01-9

:

1-(3,4-Difluorobenzyl)-2-oxo-1,2-dihydropyridine-3-carboxylicacid

Description:
1-(3,4-Difluorobenzyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a dihydropyridine ring and a carboxylic acid functional group. The presence of the 3,4-difluorobenzyl substituent contributes to its potential biological activity and lipophilicity. This compound is likely to exhibit properties typical of dihydropyridines, such as involvement in electron transfer processes and potential interactions with biological targets. The carboxylic acid group may enhance solubility in polar solvents and facilitate hydrogen bonding, which can influence its reactivity and interaction with other molecules. Additionally, the fluorine atoms can affect the compound's electronic properties, potentially enhancing its pharmacological profile. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Further studies would be necessary to elucidate its specific properties, reactivity, and potential applications in drug development.
Formula:C13H9F2NO3
InChI:InChI=1S/C13H9F2NO3/c14-10-4-3-8(6-11(10)15)7-16-5-1-2-9(12(16)17)13(18)19/h1-6H,7H2,(H,18,19)
InChI key:CQQJYSYNXKUWPX-UHFFFAOYSA-N
SMILES:C1=CN(C(=O)C(=C1)C(=O)O)CC2=CC(=C(C=C2)F)F
Found 3 products.