CymitQuimica logo

CAS 1001414-95-4

:

2-Pyridinemethanamine, 4-bromo-, hydrochloride (1:2)

Description:
2-Pyridinemethanamine, 4-bromo-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the bromine substituent at the 4-position of the pyridine ring influences its reactivity and potential applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical reactions and biological applications. This compound may exhibit properties such as basicity due to the amine functional group, which can participate in hydrogen bonding and nucleophilic reactions. Its molecular structure suggests potential uses in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's characteristics, including melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C6H7BrN2·2ClH
InChI:InChI=1S/C6H7BrN2.2ClH/c7-5-1-2-9-6(3-5)4-8;;/h1-3H,4,8H2;2*1H
InChI key:InChIKey=HFWIBRXCAIQEEY-UHFFFAOYSA-N
SMILES:C(N)C1=CC(Br)=CC=N1.Cl
Synonyms:
  • 2-Pyridinemethanamine, 4-bromo-, hydrochloride (1:2)
Found 3 products.