
CAS 100145-04-8
:2-Pentalenecarboxylicacid,octahydro-2-hydroxy-(6CI)
Description:
2-Pentalenecarboxylic acid, octahydro-2-hydroxy- (6CI), with the CAS number 100145-04-8, is a chemical compound characterized by its unique bicyclic structure, which includes a pentalene framework. This compound features a carboxylic acid functional group and a hydroxyl group, contributing to its potential reactivity and solubility in polar solvents. The presence of these functional groups suggests that it may participate in various chemical reactions, such as esterification or acid-base reactions. The octahydro configuration indicates that the compound is fully saturated, which may influence its physical properties, such as boiling and melting points, as well as its stability. Additionally, the stereochemistry of the compound can affect its biological activity and interactions with other molecules. While specific applications may vary, compounds of this nature are often explored in fields such as organic synthesis, pharmaceuticals, and materials science due to their structural complexity and functional versatility.
Formula:C9H14O3
InChI:InChI=1S/C9H14O3/c10-8(11)9(12)4-6-2-1-3-7(6)5-9/h6-7,12H,1-5H2,(H,10,11)
InChI key:REHDMQHODVWWPT-UHFFFAOYSA-N
SMILES:C1CC2CC(CC2C1)(C(=O)O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
