CymitQuimica logo

CAS 1001463-32-6

:

Pyridine,4-bromo-2-(chloromethyl)-

Description:
Pyridine, 4-bromo-2-(chloromethyl)- is a heterocyclic organic compound characterized by a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and chloromethyl groups at specific positions on the ring significantly influences its chemical reactivity and properties. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. The bromine and chloromethyl groups can participate in nucleophilic substitution reactions, making this compound a valuable intermediate in various chemical transformations. Additionally, pyridine derivatives often display biological activity, which may be relevant for medicinal chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance, as it may pose health risks and environmental concerns.
Formula:C6H5BrClN
InChI:InChI=1S/C6H5BrClN/c7-5-1-2-9-6(3-5)4-8/h1-3H,4H2
InChI key:JJTOQZAHQZOCKN-UHFFFAOYSA-N
SMILES:C1=CN=C(C=C1Br)CCl
Found 4 products.