CymitQuimica logo

CAS 1001500-66-8

:

1-(Methoxymethyl)-1H-pyrazole-3-carboxylic acid

Description:
1-(Methoxymethyl)-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methoxymethyl group, which contributes to its solubility and reactivity, and a carboxylic acid functional group that imparts acidic properties. The presence of the carboxylic acid allows for potential hydrogen bonding and reactivity in various chemical reactions, making it useful in organic synthesis and medicinal chemistry. The compound's molecular structure suggests it may exhibit biological activity, potentially serving as a scaffold for drug development. Its CAS number, 1001500-66-8, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and databases. Overall, 1-(Methoxymethyl)-1H-pyrazole-3-carboxylic acid is of interest in research due to its unique structural features and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C6H8N2O3
InChI:InChI=1S/C6H8N2O3/c1-11-4-8-3-2-5(7-8)6(9)10/h2-3H,4H2,1H3,(H,9,10)
InChI key:InChIKey=IAXSBZCOEZTYDX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NN(COC)C=C1
Synonyms:
  • 1-(Methoxymethyl)-1H-pyrazole-3-carboxylic acid
  • 1H-Pyrazole-3-carboxylic acid, 1-(methoxymethyl)-
Found 1 products.